C22H16ClFN4O5 — CID 19412706
N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19412706) has the molecular formula C22H16ClFN4O5 and a molecular weight of 470.84 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19412706 |
| Molecular Formula | C22H16ClFN4O5 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-4-yl]-5-[(4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccc(F)cc2Cl)c1)c1ccc(COc2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C22H16ClFN4O5/c23-20-9-15(24)2-1-14(20)11-27-12-16(10-25-27)26-22(29)21-8-7-19(33-21)13-32-18-5-3-17(4-6-18)28(30)31/h1-10,12H,11,13H2,(H,26,29) |
| InChIKey | YRWJNYOAZRAWSU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|