C22H14BrCl2FN4O5 — CID 19459567
N-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19459567) has the molecular formula C22H14BrCl2FN4O5 and a molecular weight of 584.19 g/mol. Its IUPAC name is N-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19459567 |
| Molecular Formula | C22H14BrCl2FN4O5 |
| Molecular Weight | 584.19 g/mol |
| Exact Mass | 581.95 |
| IUPAC Name | N-[4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1nn(Cc2c(F)cccc2Cl)cc1Br)c1ccc(COc2cc([N+](=O)[O-])ccc2Cl)o1 |
| InChI | InChI=1S/C22H14BrCl2FN4O5/c23-15-10-29(9-14-16(24)2-1-3-18(14)26)28-21(15)27-22(31)19-7-5-13(35-19)11-34-20-8-12(30(32)33)4-6-17(20)25/h1-8,10H,9,11H2,(H,27,28,31) |
| InChIKey | HXAFGJMDOPWRCA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.19 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|