C21H15Cl2N5O5 — CID 19446417
N-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19446417) has the molecular formula C21H15Cl2N5O5 and a molecular weight of 488.29 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446417 |
| Molecular Formula | C21H15Cl2N5O5 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccc(Cl)c(Cl)c2)n1)c1ccc(COc2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C21H15Cl2N5O5/c22-15-7-5-13(9-16(15)23)10-27-12-24-21(26-27)25-20(29)19-8-6-14(33-19)11-32-18-4-2-1-3-17(18)28(30)31/h1-9,12H,10-11H2,(H,25,26,29) |
| InChIKey | XVRMDXGYOOOSGP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|