C21H16FN5O5 — CID 19446422
N-[1-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19446422) has the molecular formula C21H16FN5O5 and a molecular weight of 437.39 g/mol. Its IUPAC name is N-[1-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446422 |
| Molecular Formula | C21H16FN5O5 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-[1-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccccc2F)n1)c1ccc(COc2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C21H16FN5O5/c22-16-6-2-1-5-14(16)11-26-13-23-21(25-26)24-20(28)19-10-9-15(32-19)12-31-18-8-4-3-7-17(18)27(29)30/h1-10,13H,11-12H2,(H,24,25,28) |
| InChIKey | GVWPLOYXCUDZSF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|