C17H21N5O4 — CID 19341766
1-methyl-4-[(2-methyl-3-nitrobenzoyl)amino]-N-(2-methylpropyl)pyrazole-5-carboxamide (PubChem CID 19341766) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-methyl-4-[(2-methyl-3-nitrobenzoyl)amino]-N-(2-methylpropyl)pyrazole-5-carboxamide.
| Compound Name | 1-methyl-4-[(2-methyl-3-nitrobenzoyl)amino]-N-(2-methylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19341766 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-methyl-4-[(2-methyl-3-nitrobenzoyl)amino]-N-(2-methylpropyl)pyrazole-5-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cnn(C)c2C(=O)NCC(C)C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O4/c1-10(2)8-18-17(24)15-13(9-19-21(15)4)20-16(23)12-6-5-7-14(11(12)3)22(25)26/h5-7,9-10H,8H2,1-4H3,(H,18,24)(H,20,23) |
| InChIKey | DHFBDIJSDLRLIG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|