C12H18N4O3 — CID 19341993
1-methyl-N-(2-methylpropyl)-4-(2-oxopropanoylamino)pyrazole-5-carboxamide (PubChem CID 19341993) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-methyl-N-(2-methylpropyl)-4-(2-oxopropanoylamino)pyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-(2-methylpropyl)-4-(2-oxopropanoylamino)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19341993 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-methyl-N-(2-methylpropyl)-4-(2-oxopropanoylamino)pyrazole-5-carboxamide |
| SMILES | CC(=O)C(=O)Nc1cnn(C)c1C(=O)NCC(C)C |
| InChI | InChI=1S/C12H18N4O3/c1-7(2)5-13-12(19)10-9(6-14-16(10)4)15-11(18)8(3)17/h6-7H,5H2,1-4H3,(H,13,19)(H,15,18) |
| InChIKey | RIJREIPYJWADCN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|