C22H27N7O4 — CID 19341836
4-[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-1-methyl-N-(2-methylpropyl)pyrazole-5-carboxamide (PubChem CID 19341836) has the molecular formula C22H27N7O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 4-[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-1-methyl-N-(2-methylpropyl)pyrazole-5-carboxamide.
| Compound Name | 4-[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-1-methyl-N-(2-methylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19341836 |
| Molecular Formula | C22H27N7O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-1-methyl-N-(2-methylpropyl)pyrazole-5-carboxamide |
| SMILES | Cc1nn(Cc2cccc(C(=O)Nc3cnn(C)c3C(=O)NCC(C)C)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H27N7O4/c1-13(2)10-23-22(31)20-18(11-24-27(20)5)25-21(30)17-8-6-7-16(9-17)12-28-15(4)19(29(32)33)14(3)26-28/h6-9,11,13H,10,12H2,1-5H3,(H,23,31)(H,25,30) |
| InChIKey | PHZQNQONBNKSBS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|