C25H25FN6O3 — CID 19409678
3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]benzamide (PubChem CID 19409678) has the molecular formula C25H25FN6O3 and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]benzamide.
| Compound Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19409678 |
| Molecular Formula | C25H25FN6O3 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]benzamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(C)c1NC(=O)c1cccc(Cn2nc(C)c([N+](=O)[O-])c2C)c1 |
| InChI | InChI=1S/C25H25FN6O3/c1-15-23(17(3)30(28-15)13-19-8-10-22(26)11-9-19)27-25(33)21-7-5-6-20(12-21)14-31-18(4)24(32(34)35)16(2)29-31/h5-12H,13-14H2,1-4H3,(H,27,33) |
| InChIKey | OXNRKYCCFIHWIH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|