C25H24Cl2N6O3 — CID 19337732
N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide (PubChem CID 19337732) has the molecular formula C25H24Cl2N6O3 and a molecular weight of 527.41 g/mol. Its IUPAC name is N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide.
| Compound Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 19337732 |
| Molecular Formula | C25H24Cl2N6O3 |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | N-[1-[(2,6-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c(C)c1NC(=O)c1ccc(Cn2nc(C)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C25H24Cl2N6O3/c1-14-23(16(3)32(29-14)13-20-21(26)6-5-7-22(20)27)28-25(34)19-10-8-18(9-11-19)12-31-17(4)24(33(35)36)15(2)30-31/h5-11H,12-13H2,1-4H3,(H,28,34) |
| InChIKey | DHJOSVFVMGYGAH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|