C20H20N4O3 — CID 17088718
N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-4-nitrobenzamide (PubChem CID 17088718) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-4-nitrobenzamide.
| Compound Name | N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 17088718 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-4-nitrobenzamide |
| SMILES | Cc1ccc(Cn2nc(C)c(NC(=O)c3ccc([N+](=O)[O-])cc3)c2C)cc1 |
| InChI | InChI=1S/C20H20N4O3/c1-13-4-6-16(7-5-13)12-23-15(3)19(14(2)22-23)21-20(25)17-8-10-18(11-9-17)24(26)27/h4-11H,12H2,1-3H3,(H,21,25) |
| InChIKey | RYWJYFPCOFALSW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|