C19H17FN4O3 — CID 19408260
N-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-nitrobenzamide (PubChem CID 19408260) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is N-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-nitrobenzamide.
| Compound Name | N-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 19408260 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-4-nitrobenzamide |
| SMILES | Cc1nn(Cc2ccccc2F)c(C)c1NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17FN4O3/c1-12-18(21-19(25)14-7-9-16(10-8-14)24(26)27)13(2)23(22-12)11-15-5-3-4-6-17(15)20/h3-10H,11H2,1-2H3,(H,21,25) |
| InChIKey | WUSHSTIJJKRFDS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|