C17H12BrFN4O3 — CID 19287718
N-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-4-nitrobenzamide (PubChem CID 19287718) has the molecular formula C17H12BrFN4O3 and a molecular weight of 419.21 g/mol. Its IUPAC name is N-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-4-nitrobenzamide.
| Compound Name | N-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 19287718 |
| Molecular Formula | C17H12BrFN4O3 |
| Molecular Weight | 419.21 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | N-[4-bromo-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-4-nitrobenzamide |
| SMILES | O=C(Nc1nn(Cc2ccccc2F)cc1Br)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12BrFN4O3/c18-14-10-22(9-12-3-1-2-4-15(12)19)21-16(14)20-17(24)11-5-7-13(8-6-11)23(25)26/h1-8,10H,9H2,(H,20,21,24) |
| InChIKey | KWVMQXNAMKXOOI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|