C23H20Cl2N6O3 — CID 19344927
N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide (PubChem CID 19344927) has the molecular formula C23H20Cl2N6O3 and a molecular weight of 499.36 g/mol. Its IUPAC name is N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide.
| Compound Name | N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 19344927 |
| Molecular Formula | C23H20Cl2N6O3 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3nn(Cc4ccccc4Cl)cc3Cl)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H20Cl2N6O3/c1-14-21(31(33)34)15(2)30(27-14)11-16-7-9-17(10-8-16)23(32)26-22-20(25)13-29(28-22)12-18-5-3-4-6-19(18)24/h3-10,13H,11-12H2,1-2H3,(H,26,28,32) |
| InChIKey | CNDYPDPMGHXGBQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|