C16H16N4O3 — CID 27741139
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-prop-2-ynylbenzamide (PubChem CID 27741139) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-prop-2-ynylbenzamide.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 27741139 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccc(Cn2nc(C)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C16H16N4O3/c1-4-9-17-16(21)14-7-5-13(6-8-14)10-19-12(3)15(20(22)23)11(2)18-19/h1,5-8H,9-10H2,2-3H3,(H,17,21) |
| InChIKey | QPJFLQLAJKFEAH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|