C21H22N6O5 — CID 41275585
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(2-nitroanilino)ethyl]benzamide (PubChem CID 41275585) has the molecular formula C21H22N6O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(2-nitroanilino)ethyl]benzamide.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 41275585 |
| Molecular Formula | C21H22N6O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(2-nitroanilino)ethyl]benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)NCCNc3ccccc3[N+](=O)[O-])cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22N6O5/c1-14-20(27(31)32)15(2)25(24-14)13-16-7-9-17(10-8-16)21(28)23-12-11-22-18-5-3-4-6-19(18)26(29)30/h3-10,22H,11-13H2,1-2H3,(H,23,28) |
| InChIKey | FMNKBZWSENBZMT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 145.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|