C15H18ClN5O3 — CID 47049422
2-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[2-(2-nitroanilino)ethyl]acetamide (PubChem CID 47049422) has the molecular formula C15H18ClN5O3 and a molecular weight of 351.79 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[2-(2-nitroanilino)ethyl]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[2-(2-nitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 47049422 |
| Molecular Formula | C15H18ClN5O3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[2-(2-nitroanilino)ethyl]acetamide |
| SMILES | Cc1nn(CC(=O)NCCNc2ccccc2[N+](=O)[O-])c(C)c1Cl |
| InChI | InChI=1S/C15H18ClN5O3/c1-10-15(16)11(2)20(19-10)9-14(22)18-8-7-17-12-5-3-4-6-13(12)21(23)24/h3-6,17H,7-9H2,1-2H3,(H,18,22) |
| InChIKey | LMICYUSRCXDTJE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|