C19H24N6O3 — CID 46634740
3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]-N-[2-(2-nitroanilino)ethyl]propanamide (PubChem CID 46634740) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]-N-[2-(2-nitroanilino)ethyl]propanamide.
| Compound Name | 3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]-N-[2-(2-nitroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 46634740 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]-N-[2-(2-nitroanilino)ethyl]propanamide |
| SMILES | Cc1nn(CCC#N)c(C)c1CCC(=O)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N6O3/c1-14-16(15(2)24(23-14)13-5-10-20)8-9-19(26)22-12-11-21-17-6-3-4-7-18(17)25(27)28/h3-4,6-7,21H,5,8-9,11-13H2,1-2H3,(H,22,26) |
| InChIKey | TURCGXMAOCVMND-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|