C19H23ClN4OS — CID 31406205
N-[2-(4-chlorophenyl)sulfanylethyl]-3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanamide (PubChem CID 31406205) has the molecular formula C19H23ClN4OS and a molecular weight of 390.94 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 31406205 |
| Molecular Formula | C19H23ClN4OS |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanamide |
| SMILES | Cc1nn(CCC#N)c(C)c1CCC(=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClN4OS/c1-14-18(15(2)24(23-14)12-3-10-21)8-9-19(25)22-11-13-26-17-6-4-16(20)5-7-17/h4-7H,3,8-9,11-13H2,1-2H3,(H,22,25) |
| InChIKey | XGAQHWHLJGYTSL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|