C25H26ClN5O3 — CID 46634737
4-[(4-chlorophenoxy)methyl]-N'-[3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanoyl]benzohydrazide (PubChem CID 46634737) has the molecular formula C25H26ClN5O3 and a molecular weight of 479.97 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-N'-[3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanoyl]benzohydrazide.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-N'-[3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 46634737 |
| Molecular Formula | C25H26ClN5O3 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-N'-[3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]propanoyl]benzohydrazide |
| SMILES | Cc1nn(CCC#N)c(C)c1CCC(=O)NNC(=O)c1ccc(COc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H26ClN5O3/c1-17-23(18(2)31(30-17)15-3-14-27)12-13-24(32)28-29-25(33)20-6-4-19(5-7-20)16-34-22-10-8-21(26)9-11-22/h4-11H,3,12-13,15-16H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | MJDXWOOQUJGQJK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|