C21H26FN5O — CID 55889413
3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 55889413) has the molecular formula C21H26FN5O and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 55889413 |
| Molecular Formula | C21H26FN5O |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | Cc1nn(CCC#N)c(C)c1CCC(=O)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C21H26FN5O/c1-15-18(16(2)27(25-15)13-5-10-23)7-9-21(28)24-17-6-8-20(19(22)14-17)26-11-3-4-12-26/h6,8,14H,3-5,7,9,11-13H2,1-2H3,(H,24,28) |
| InChIKey | GZHWKIJXEZBGBR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|