C21H23N5O4 — CID 56515821
N'-(2-cyanoethyl)-N-[2-(2-nitroanilino)ethyl]-N'-phenylbutanediamide (PubChem CID 56515821) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[2-(2-nitroanilino)ethyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[2-(2-nitroanilino)ethyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56515821 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[2-(2-nitroanilino)ethyl]-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NCCNc1ccccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C21H23N5O4/c22-13-6-16-25(17-7-2-1-3-8-17)21(28)12-11-20(27)24-15-14-23-18-9-4-5-10-19(18)26(29)30/h1-5,7-10,23H,6,11-12,14-16H2,(H,24,27) |
| InChIKey | LOFYDNMPANQQKQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|