C18H21N5O5 — CID 31738306
4-(4-nitroanilino)-N-[2-(2-nitroanilino)ethyl]butanamide (PubChem CID 31738306) has the molecular formula C18H21N5O5 and a molecular weight of 387.40 g/mol. Its IUPAC name is 4-(4-nitroanilino)-N-[2-(2-nitroanilino)ethyl]butanamide.
| Compound Name | 4-(4-nitroanilino)-N-[2-(2-nitroanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 31738306 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-(4-nitroanilino)-N-[2-(2-nitroanilino)ethyl]butanamide |
| SMILES | O=C(CCCNc1ccc([N+](=O)[O-])cc1)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N5O5/c24-18(6-3-11-19-14-7-9-15(10-8-14)22(25)26)21-13-12-20-16-4-1-2-5-17(16)23(27)28/h1-2,4-5,7-10,19-20H,3,6,11-13H2,(H,21,24) |
| InChIKey | UOBSZJIXRTZHKD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|