C13H21ClN4O3 — CID 119407663
N-(3-aminopropyl)-4-(4-nitroanilino)butanamide;hydrochloride (PubChem CID 119407663) has the molecular formula C13H21ClN4O3 and a molecular weight of 316.79 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(4-nitroanilino)butanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-4-(4-nitroanilino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119407663 |
| Molecular Formula | C13H21ClN4O3 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(3-aminopropyl)-4-(4-nitroanilino)butanamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)CCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H20N4O3.ClH/c14-8-2-10-16-13(18)3-1-9-15-11-4-6-12(7-5-11)17(19)20;/h4-7,15H,1-3,8-10,14H2,(H,16,18);1H |
| InChIKey | AUWQHSZPMUGIJC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|