C17H27ClN4O3 — CID 119611458
N-[2-(aminomethyl)cyclohexyl]-4-(4-nitroanilino)butanamide;hydrochloride (PubChem CID 119611458) has the molecular formula C17H27ClN4O3 and a molecular weight of 370.88 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-(4-nitroanilino)butanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-(4-nitroanilino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119611458 |
| Molecular Formula | C17H27ClN4O3 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-(4-nitroanilino)butanamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)CCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H26N4O3.ClH/c18-12-13-4-1-2-5-16(13)20-17(22)6-3-11-19-14-7-9-15(10-8-14)21(23)24;/h7-10,13,16,19H,1-6,11-12,18H2,(H,20,22);1H |
| InChIKey | VPYUZEUDMLDIAY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|