C15H20N4O4 — CID 95339539
(2R)-1-[4-(4-nitroanilino)butanoyl]pyrrolidine-2-carboxamide (PubChem CID 95339539) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is (2R)-1-[4-(4-nitroanilino)butanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[4-(4-nitroanilino)butanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95339539 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2R)-1-[4-(4-nitroanilino)butanoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN1C(=O)CCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N4O4/c16-15(21)13-3-2-10-18(13)14(20)4-1-9-17-11-5-7-12(8-6-11)19(22)23/h5-8,13,17H,1-4,9-10H2,(H2,16,21)/t13-/m1/s1 |
| InChIKey | ZLXRQHQRQYOIPO-CYBMUJFWSA-N |
| XLogP | 1.26 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|