C16H21N3O5S — CID 119210504
2-[4-[4-(4-nitroanilino)butanoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 119210504) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[4-[4-(4-nitroanilino)butanoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[4-(4-nitroanilino)butanoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 119210504 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[4-[4-(4-nitroanilino)butanoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)CCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H21N3O5S/c20-15(18-8-9-25-11-14(18)10-16(21)22)2-1-7-17-12-3-5-13(6-4-12)19(23)24/h3-6,14,17H,1-2,7-11H2,(H,21,22) |
| InChIKey | IPQZNIZDGKCMFL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|