C14H21ClN4O3 — CID 119412131
1-[(3R)-3-aminopyrrolidin-1-yl]-4-(4-nitroanilino)butan-1-one;hydrochloride (PubChem CID 119412131) has the molecular formula C14H21ClN4O3 and a molecular weight of 328.80 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-4-(4-nitroanilino)butan-1-one;hydrochloride.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-4-(4-nitroanilino)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119412131 |
| Molecular Formula | C14H21ClN4O3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-4-(4-nitroanilino)butan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)CCCNc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C14H20N4O3.ClH/c15-11-7-9-17(10-11)14(19)2-1-8-16-12-3-5-13(6-4-12)18(20)21;/h3-6,11,16H,1-2,7-10,15H2;1H/t11-;/m1./s1 |
| InChIKey | CXWGSMUKIKUKBQ-RFVHGSKJSA-N |
| XLogP | 1.77 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|