C21H28N6O4 — CID 86973524
N-(1-ethylpyrazol-4-yl)-1-[4-(4-nitroanilino)butanoyl]piperidine-4-carboxamide (PubChem CID 86973524) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-(1-ethylpyrazol-4-yl)-1-[4-(4-nitroanilino)butanoyl]piperidine-4-carboxamide.
| Compound Name | N-(1-ethylpyrazol-4-yl)-1-[4-(4-nitroanilino)butanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86973524 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-(1-ethylpyrazol-4-yl)-1-[4-(4-nitroanilino)butanoyl]piperidine-4-carboxamide |
| SMILES | CCn1cc(NC(=O)C2CCN(C(=O)CCCNc3ccc([N+](=O)[O-])cc3)CC2)cn1 |
| InChI | InChI=1S/C21H28N6O4/c1-2-26-15-18(14-23-26)24-21(29)16-9-12-25(13-10-16)20(28)4-3-11-22-17-5-7-19(8-6-17)27(30)31/h5-8,14-16,22H,2-4,9-13H2,1H3,(H,24,29) |
| InChIKey | YKZFQJVQLDDNKJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 122.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|