C17H26N4O3 — CID 56786192
1-(4-ethyl-1,4-diazepan-1-yl)-4-(4-nitroanilino)butan-1-one (PubChem CID 56786192) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-(4-ethyl-1,4-diazepan-1-yl)-4-(4-nitroanilino)butan-1-one.
| Compound Name | 1-(4-ethyl-1,4-diazepan-1-yl)-4-(4-nitroanilino)butan-1-one |
|---|---|
| PubChem CID | 56786192 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-(4-ethyl-1,4-diazepan-1-yl)-4-(4-nitroanilino)butan-1-one |
| SMILES | CCN1CCCN(C(=O)CCCNc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H26N4O3/c1-2-19-11-4-12-20(14-13-19)17(22)5-3-10-18-15-6-8-16(9-7-15)21(23)24/h6-9,18H,2-5,10-14H2,1H3 |
| InChIKey | OBIRLPWFKHQDQH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|