C11H14N4O2S — CID 162511170
(3R)-3-amino-N-(4-nitrophenyl)pyrrolidine-1-carbothioamide (PubChem CID 162511170) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is (3R)-3-amino-N-(4-nitrophenyl)pyrrolidine-1-carbothioamide.
| Compound Name | (3R)-3-amino-N-(4-nitrophenyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 162511170 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (3R)-3-amino-N-(4-nitrophenyl)pyrrolidine-1-carbothioamide |
| SMILES | N[C@@H]1CCN(C(=S)Nc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C11H14N4O2S/c12-8-5-6-14(7-8)11(18)13-9-1-3-10(4-2-9)15(16)17/h1-4,8H,5-7,12H2,(H,13,18)/t8-/m1/s1 |
| InChIKey | NPYZJLIXVZBDOA-MRVPVSSYSA-N |
| XLogP | 1.32 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|