C13H16N4O3S — CID 8628913
(3R)-1-[(4-nitrophenyl)carbamothioyl]piperidine-3-carboxamide (PubChem CID 8628913) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is (3R)-1-[(4-nitrophenyl)carbamothioyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[(4-nitrophenyl)carbamothioyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 8628913 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (3R)-1-[(4-nitrophenyl)carbamothioyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(C(=S)Nc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C13H16N4O3S/c14-12(18)9-2-1-7-16(8-9)13(21)15-10-3-5-11(6-4-10)17(19)20/h3-6,9H,1-2,7-8H2,(H2,14,18)(H,15,21)/t9-/m1/s1 |
| InChIKey | JEGPVTWQZUBGNQ-SECBINFHSA-N |
| XLogP | 1.49 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|