C15H22N4O3S2 — CID 8628883
(3S)-1-[[3-(dimethylsulfamoyl)phenyl]carbamothioyl]piperidine-3-carboxamide (PubChem CID 8628883) has the molecular formula C15H22N4O3S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is (3S)-1-[[3-(dimethylsulfamoyl)phenyl]carbamothioyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[[3-(dimethylsulfamoyl)phenyl]carbamothioyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 8628883 |
| Molecular Formula | C15H22N4O3S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (3S)-1-[[3-(dimethylsulfamoyl)phenyl]carbamothioyl]piperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)N2CCC[C@H](C(N)=O)C2)c1 |
| InChI | InChI=1S/C15H22N4O3S2/c1-18(2)24(21,22)13-7-3-6-12(9-13)17-15(23)19-8-4-5-11(10-19)14(16)20/h3,6-7,9,11H,4-5,8,10H2,1-2H3,(H2,16,20)(H,17,23)/t11-/m0/s1 |
| InChIKey | KPFNXRCNDAQZEQ-NSHDSACASA-N |
| XLogP | 0.83 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|