C20H32N4O3S2 — CID 43076515
1-[[3-(dimethylsulfamoyl)phenyl]carbamothioyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 43076515) has the molecular formula C20H32N4O3S2 and a molecular weight of 440.64 g/mol. Its IUPAC name is 1-[[3-(dimethylsulfamoyl)phenyl]carbamothioyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[[3-(dimethylsulfamoyl)phenyl]carbamothioyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 43076515 |
| Molecular Formula | C20H32N4O3S2 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-[[3-(dimethylsulfamoyl)phenyl]carbamothioyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=S)Nc2cccc(S(=O)(=O)N(C)C)c2)CC1 |
| InChI | InChI=1S/C20H32N4O3S2/c1-4-5-6-12-21-19(25)16-10-13-24(14-11-16)20(28)22-17-8-7-9-18(15-17)29(26,27)23(2)3/h7-9,15-16H,4-6,10-14H2,1-3H3,(H,21,25)(H,22,28) |
| InChIKey | MMNIEMUYIAAMSU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|