C19H27F2N3OS2 — CID 43076499
1-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 43076499) has the molecular formula C19H27F2N3OS2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 43076499 |
| Molecular Formula | C19H27F2N3OS2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=S)Nc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H27F2N3OS2/c1-2-3-4-11-22-17(25)14-9-12-24(13-10-14)19(26)23-15-5-7-16(8-6-15)27-18(20)21/h5-8,14,18H,2-4,9-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | KXFKIAAHRXYMCS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|