C19H27FN2O2S — CID 55717756
1-[2-(4-fluorophenyl)sulfanylacetyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 55717756) has the molecular formula C19H27FN2O2S and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)sulfanylacetyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(4-fluorophenyl)sulfanylacetyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55717756 |
| Molecular Formula | C19H27FN2O2S |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-[2-(4-fluorophenyl)sulfanylacetyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=O)CSc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H27FN2O2S/c1-2-3-4-11-21-19(24)15-9-12-22(13-10-15)18(23)14-25-17-7-5-16(20)6-8-17/h5-8,15H,2-4,9-14H2,1H3,(H,21,24) |
| InChIKey | GZQBIOHYAUJEOG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|