C24H34N4O2S — CID 55839021
1-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 55839021) has the molecular formula C24H34N4O2S and a molecular weight of 442.63 g/mol. Its IUPAC name is 1-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55839021 |
| Molecular Formula | C24H34N4O2S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-[2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=O)CSc2nccn2-c2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C24H34N4O2S/c1-4-5-6-9-25-23(30)20-7-11-27(12-8-20)22(29)17-31-24-26-10-13-28(24)21-15-18(2)14-19(3)16-21/h10,13-16,20H,4-9,11-12,17H2,1-3H3,(H,25,30) |
| InChIKey | WKWQDWYLNBTTAN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|