C19H26FN3O3 — CID 42878774
1-butanoyl-N-[2-[(4-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide (PubChem CID 42878774) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-butanoyl-N-[2-[(4-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-butanoyl-N-[2-[(4-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42878774 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-butanoyl-N-[2-[(4-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide |
| SMILES | CCCC(=O)N1CCC(C(=O)NCCNC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H26FN3O3/c1-2-3-17(24)23-12-8-15(9-13-23)19(26)22-11-10-21-18(25)14-4-6-16(20)7-5-14/h4-7,15H,2-3,8-13H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | ZBNYKTNHGQKCKV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|