C22H22Cl2FN3O3 — CID 24717415
1-(3,4-dichlorobenzoyl)-N-[2-[(4-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide (PubChem CID 24717415) has the molecular formula C22H22Cl2FN3O3 and a molecular weight of 466.34 g/mol. Its IUPAC name is 1-(3,4-dichlorobenzoyl)-N-[2-[(4-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(3,4-dichlorobenzoyl)-N-[2-[(4-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24717415 |
| Molecular Formula | C22H22Cl2FN3O3 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 1-(3,4-dichlorobenzoyl)-N-[2-[(4-fluorobenzoyl)amino]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCN(C(=O)c2ccc(Cl)c(Cl)c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H22Cl2FN3O3/c23-18-6-3-16(13-19(18)24)22(31)28-11-7-15(8-12-28)21(30)27-10-9-26-20(29)14-1-4-17(25)5-2-14/h1-6,13,15H,7-12H2,(H,26,29)(H,27,30) |
| InChIKey | VOLFPTAMGJZKQR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|