C14H16Cl2N2O4S — CID 78868268
N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 78868268) has the molecular formula C14H16Cl2N2O4S and a molecular weight of 379.27 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 78868268 |
| Molecular Formula | C14H16Cl2N2O4S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCS(=O)(=O)C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O4S/c15-11-2-1-9(7-12(11)16)13(19)17-4-5-18-14(20)10-3-6-23(21,22)8-10/h1-2,7,10H,3-6,8H2,(H,17,19)(H,18,20) |
| InChIKey | LOTFUDAPYNNBND-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|