C11H12ClNO3S — CID 64906044
(4-amino-3-chlorophenyl)-(1,1-dioxothiolan-3-yl)methanone (PubChem CID 64906044) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is (4-amino-3-chlorophenyl)-(1,1-dioxothiolan-3-yl)methanone.
| Compound Name | (4-amino-3-chlorophenyl)-(1,1-dioxothiolan-3-yl)methanone |
|---|---|
| PubChem CID | 64906044 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | (4-amino-3-chlorophenyl)-(1,1-dioxothiolan-3-yl)methanone |
| SMILES | Nc1ccc(C(=O)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C11H12ClNO3S/c12-9-5-7(1-2-10(9)13)11(14)8-3-4-17(15,16)6-8/h1-2,5,8H,3-4,6,13H2 |
| InChIKey | BWKHPFYNOSGDHN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|