C12H13FO3S — CID 115336304
(1,1-dioxothiolan-3-yl)-(3-fluoro-5-methylphenyl)methanone (PubChem CID 115336304) has the molecular formula C12H13FO3S and a molecular weight of 256.30 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(3-fluoro-5-methylphenyl)methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-(3-fluoro-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 115336304 |
| Molecular Formula | C12H13FO3S |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(3-fluoro-5-methylphenyl)methanone |
| SMILES | Cc1cc(F)cc(C(=O)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H13FO3S/c1-8-4-10(6-11(13)5-8)12(14)9-2-3-17(15,16)7-9/h4-6,9H,2-3,7H2,1H3 |
| InChIKey | ZLIUGLPDTFITQK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |