C13H13NO4S — CID 65336107
5-(1,1-dioxothiolane-3-carbonyl)-2-methoxybenzonitrile (PubChem CID 65336107) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is 5-(1,1-dioxothiolane-3-carbonyl)-2-methoxybenzonitrile.
| Compound Name | 5-(1,1-dioxothiolane-3-carbonyl)-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 65336107 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5-(1,1-dioxothiolane-3-carbonyl)-2-methoxybenzonitrile |
| SMILES | COc1ccc(C(=O)C2CCS(=O)(=O)C2)cc1C#N |
| InChI | InChI=1S/C13H13NO4S/c1-18-12-3-2-9(6-11(12)7-14)13(15)10-4-5-19(16,17)8-10/h2-3,6,10H,4-5,8H2,1H3 |
| InChIKey | RGDHBELEJWNOHB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |