About 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile
2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile (PubChem CID 171939780) has the molecular formula C16H17NO3S
and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile.
Molecular Properties
| Compound Name | 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile |
| PubChem CID | 171939780 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile |
| SMILES | COc1ccc(C(=O)C2CC3CCC(C2)S3=O)cc1C#N |
| InChI | InChI=1S/C16H17NO3S/c1-20-15-5-2-10(6-12(15)9-17)16(18)11-7-13-3-4-14(8-11)21(13)19/h2,5-6,11,13-14H,3-4,7-8H2,1H3 |
| InChIKey | CXUZNJMLOBXHLR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile?
The IUPAC name of 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile (CID 171939780) is 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile.
What is the SMILES notation for 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile?
The canonical SMILES for 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile is COc1ccc(C(=O)C2CC3CCC(C2)S3=O)cc1C#N.
What is the InChIKey of 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile?
The InChIKey is CXUZNJMLOBXHLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3S/c1-20-15-5-2-10(6-12(15)9-17)16(18)11-7-13-3-4-14(8-11)21(13)19/h2,5-6,11,13-14H,3-4,7-8H2,1H3.
What are the key properties of 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile?
2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile has a molecular weight of 303.38 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-(8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carbonyl)benzonitrile is sourced from PubChem (CID 171939780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).