C16H20O3S — CID 171946940
(4-ethoxyphenyl)-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 171946940) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is (4-ethoxyphenyl)-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | (4-ethoxyphenyl)-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 171946940 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (4-ethoxyphenyl)-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | CCOc1ccc(C(=O)C2CC3CCC(C2)S3=O)cc1 |
| InChI | InChI=1S/C16H20O3S/c1-2-19-13-5-3-11(4-6-13)16(17)12-9-14-7-8-15(10-12)20(14)18/h3-6,12,14-15H,2,7-10H2,1H3 |
| InChIKey | KKIZTLXUGRLTKF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |