C15H16F2O3S — CID 171940404
[4-(difluoromethoxy)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 171940404) has the molecular formula C15H16F2O3S and a molecular weight of 314.35 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | [4-(difluoromethoxy)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 171940404 |
| Molecular Formula | C15H16F2O3S |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | [4-(difluoromethoxy)phenyl]-(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | O=C(c1ccc(OC(F)F)cc1)C1CC2CCC(C1)S2=O |
| InChI | InChI=1S/C15H16F2O3S/c16-15(17)20-11-3-1-9(2-4-11)14(18)10-7-12-5-6-13(8-10)21(12)19/h1-4,10,12-13,15H,5-8H2 |
| InChIKey | IGFOZDWYOIZQTB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |