C16H18F2O2S — CID 171947685
[4-(difluoromethyl)phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171947685) has the molecular formula C16H18F2O2S and a molecular weight of 312.38 g/mol. Its IUPAC name is [4-(difluoromethyl)phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | [4-(difluoromethyl)phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171947685 |
| Molecular Formula | C16H18F2O2S |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [4-(difluoromethyl)phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | O=C(c1ccc(C(F)F)cc1)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C16H18F2O2S/c17-16(18)11-6-4-10(5-7-11)15(19)12-8-13-2-1-3-14(9-12)21(13)20/h4-7,12-14,16H,1-3,8-9H2 |
| InChIKey | JUEARRLHKBOTSW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |