C18H24O4S — CID 171949426
[2-(dimethoxymethyl)phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171949426) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is [2-(dimethoxymethyl)phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | [2-(dimethoxymethyl)phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171949426 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [2-(dimethoxymethyl)phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | COC(OC)c1ccccc1C(=O)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C18H24O4S/c1-21-18(22-2)16-9-4-3-8-15(16)17(19)12-10-13-6-5-7-14(11-12)23(13)20/h3-4,8-9,12-14,18H,5-7,10-11H2,1-2H3 |
| InChIKey | PWJXQAAVZAHERD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|