C18H20O2S — CID 171945951
1H-inden-2-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171945951) has the molecular formula C18H20O2S and a molecular weight of 300.42 g/mol. Its IUPAC name is 1H-inden-2-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | 1H-inden-2-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171945951 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1H-inden-2-yl-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | O=C(C1=Cc2ccccc2C1)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C18H20O2S/c19-18(14-8-12-4-1-2-5-13(12)9-14)15-10-16-6-3-7-17(11-15)21(16)20/h1-2,4-5,8,15-17H,3,6-7,9-11H2 |
| InChIKey | DPNYQGMTIOYNGS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |