C21H22O2S — CID 171943287
(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-(4-phenylphenyl)methanone (PubChem CID 171943287) has the molecular formula C21H22O2S and a molecular weight of 338.47 g/mol. Its IUPAC name is (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-(4-phenylphenyl)methanone.
| Compound Name | (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 171943287 |
| Molecular Formula | C21H22O2S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-(4-phenylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C21H22O2S/c22-21(18-13-19-7-4-8-20(14-18)24(19)23)17-11-9-16(10-12-17)15-5-2-1-3-6-15/h1-3,5-6,9-12,18-20H,4,7-8,13-14H2 |
| InChIKey | PTOXEZYRUGQNNT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |