C19H26O3S — CID 171949151
[4-[(2-methylpropan-2-yl)oxy]phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171949151) has the molecular formula C19H26O3S and a molecular weight of 334.48 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxy]phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | [4-[(2-methylpropan-2-yl)oxy]phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171949151 |
| Molecular Formula | C19H26O3S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxy]phenyl]-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | CC(C)(C)Oc1ccc(C(=O)C2CC3CCCC(C2)S3=O)cc1 |
| InChI | InChI=1S/C19H26O3S/c1-19(2,3)22-15-9-7-13(8-10-15)18(20)14-11-16-5-4-6-17(12-14)23(16)21/h7-10,14,16-17H,4-6,11-12H2,1-3H3 |
| InChIKey | JVYZGPCTMNPQKX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |